Online Database of Chemicals from Around the World
|
CAS#: 52497-64-0 Product: N-Hydroxychlorphentermine No suppilers available for the product. |
| Name | N-Hydroxychlorphentermine |
|---|---|
| Synonyms | N-[2-(4-Chlorophenyl)-1,1-Dimethyl-Ethyl]Hydroxylamine; N-[2-(4-Chlorophenyl)-1,1-Dimethylethyl]Hydroxylamine; N-[1-(4-Chlorophenyl)-2-Methyl-Propan-2-Yl]Hydroxylamine |
| Molecular Structure |  |
| Molecular Formula | C10H14ClNO |
| Molecular Weight | 199.68 |
| CAS Registry Number | 52497-64-0 |
| SMILES | C1=CC(=CC=C1CC(NO)(C)C)Cl |
| InChI | 1S/C10H14ClNO/c1-10(2,12-13)7-8-3-5-9(11)6-4-8/h3-6,12-13H,7H2,1-2H3 |
| InChIKey | PLGZCSZVNLUOQF-UHFFFAOYSA-N |
| Density | 1.15g/cm3 (Cal.) |
|---|---|
| Boiling point | 316.304°C at 760 mmHg (Cal.) |
| Flash point | 145.096°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Hydroxychlorphentermine |