Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2-(2,4-Dimethylphenyl)-3-Ethylpyrrolidine |
|---|---|
| Synonyms | 2-(2,4-dimethylphenyl)-3-ethylpyrrolidine |
| Molecular Structure |  |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.32 |
| CAS Registry Number | 525537-35-3 |
| SMILES | c1(c(ccc(c1)C)C2NCCC2CC)C |
| InChI | 1S/C14H21N/c1-4-12-7-8-15-14(12)13-6-5-10(2)9-11(13)3/h5-6,9,12,14-15H,4,7-8H2,1-3H3 |
| InChIKey | KFTJJQRHZGGXTA-UHFFFAOYSA-N |
| Density | 0.928g/cm3 (Cal.) |
|---|---|
| Boiling point | 306.779°C at 760 mmHg (Cal.) |
| Flash point | 141.152°C (Cal.) |
| Refractive index | 1.507 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(2,4-Dimethylphenyl)-3-Ethylpyrrolidine |