Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Sodium 1-Sulfidobenzotriazole |
|---|---|
| Synonyms | Sodium 1H-Benzotriazolethiolate |
| Molecular Structure |  |
| Molecular Formula | C6H4N3NaS |
| Molecular Weight | 173.17 |
| CAS Registry Number | 52641-69-7 |
| EINECS | 258-065-8 |
| SMILES | C1=CC=CC2=C1[N]([S-])N=N2.[Na+] |
| InChI | 1S/C6H4N3S.Na/c10-9-6-4-2-1-3-5(6)7-8-9;/h1-4H;/q-1;+1 |
| InChIKey | XWCJOQCFCCHHPI-UHFFFAOYSA-N |
| Boiling point | 286.9°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 127.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Sodium 1-Sulfidobenzotriazole |