| AccuStandard Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (203) 786-5290 | |||
![]() |
orders@accustandard.com | |||
| Chemical manufacturer since 1986 | ||||
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Classification | Analytical chemistry >> Food safety >> Dioxins, polychlorinated biphenyls, furans |
|---|---|
| Name | 2,2',3,3',6-Pentachlorobiphenyl |
| Synonyms | 1,1'-Biphenyl, 2,2',3,3',6-Pentachloro-; 2,2',3,3',6-Pentachlorobiphenyl; 2,2',3,3',6-Pentachloro-1,1'-Biphenyl |
| Molecular Structure | ![]() |
| Molecular Formula | C12H5Cl5 |
| Molecular Weight | 326.44 |
| CAS Registry Number | 52663-60-2 |
| SMILES | C1=C(C(=C(C(=C1)Cl)C2=C(Cl)C(=CC=C2)Cl)Cl)Cl |
| InChI | 1S/C12H5Cl5/c13-7-4-5-9(15)12(17)10(7)6-2-1-3-8(14)11(6)16/h1-5H |
| InChIKey | QVWUJLANSDKRAH-UHFFFAOYSA-N |
| Density | 1.522g/cm3 (Cal.) |
|---|---|
| Boiling point | 361.879°C at 760 mmHg (Cal.) |
| Flash point | 171.091°C (Cal.) |
| (1) | H.-J. Lehmler, L. W. Robertson and S. Parkin. 2,2',3,3',6-Pentachlorobiphenyl (PCB 84), Acta Cryst. (2005). E61, o3025-o3026 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2,2',3,3',6-Pentachlorobiphenyl |