Online Database of Chemicals from Around the World

Hexa(acetato)m3-oxo-tris(aquo)triiridium acetate
[CAS 52705-52-9]

List of Suppliers
BOC Sciences USA
www.bocsci.com
+1 (631) 485-4226
+1 (631) 614-7828
info@bocsci.com
Chemical manufacturer
chemBlink Standard supplier since 2010
Hangzhou Leap Chem Co., Ltd. China
www.leapchem.com
+86 (571) 8771-1850
market19@leapchem.com
QQ Chat
Chemical manufacturer since 2006
chemBlink Standard supplier since 2015
W.C.Heraeus GmbH Germany
www.heraeus-chemicalproducts.com
+49 (6181) 355-707
+49 (6181) 355-914
info@heraeus.com
Chemical manufacturer
Shanghai Worldyang Chemical Co., Ltd. China
www.worldyachem.com
+86 13651600618
+86 (21) 5679-5779
+86 (21) 5679-5266
sales7777@worldyachem.com
QQ Chat
WeChat: 13651600618
WhatsApp:+86 13651600618
Chemical manufacturer since 2012

Identification
ClassificationOrganic raw materials >> Organometallic compound >> Organic germanium, cobalt, strontium, barium, gallium, germanium, germanium, germanium, germanium, etc.
NameHexa(acetato)m3-oxo-tris(aquo)triiridium acetate
SynonymsIridium(III) acetate
Molecular StructureHexa(acetato)m3-oxo-tris(aquo)triiridium acetate molecular structure (CAS 52705-52-9)
Molecular FormulaC12H18Ir3O15.C2H3O2.3(H2O)
Molecular Weight1092.00
CAS Registry Number52705-52-9
EC Number679-513-2
SMILESCC(=O)O[Ir]1(OC(C)=O)O[Ir](OC(C)=O)(OC(C)=O)O[Ir+](OC(C)=O)(OC(C)=O)O1.CC(=O)[O-].O.O.O
Safety Data
Hazard Symbolssymbol   GHS07 Danger  Details
Risk StatementsH290-H302-H318  Details
Safety StatementsP234-P264-P270-P280-P301+P312-P305+P351+P338-P330-P337+P313-P390-P406-P501  Details
Hazard Classification
up    Details
HazardClassCategory CodeHazard Statement
Substances or mixtures corrosive to metalsMet. Corr.1H290
Acute toxicityAcute Tox.4H302
Eye irritationEye Irrit.2H319
Transport InformationUN 1759
SDSAvailable
up Discovery and Applications
Hexa(acetato)m3-oxo-tris(aquo)triiridium acetate is a well-characterized multinuclear iridium complex featuring three iridium centers bridged by an oxo ligand and coordinated by acetate and water ligands. Its molecular structure includes three iridium atoms connected via a μ3-oxo bridge (an oxygen atom simultaneously bonded to all three metal centers), six acetate groups acting as bridging and terminal ligands, and three coordinated water molecules. Additionally, acetate anions are present as counterions, balancing the overall charge of the complex.

This compound belongs to a class of polynuclear metal-oxo clusters that have attracted attention for their unique structural, electronic, and catalytic properties. The trinuclear iridium cluster exhibits an octahedral coordination geometry around each iridium center, stabilized by bridging acetate ligands and the central μ3-oxo group. The μ3-oxo ligand plays a crucial role in linking the three metal centers, facilitating metal-metal electronic communication and structural integrity.

The synthesis of hexa(acetato)m3-oxo-tris(aquo)triiridium acetate typically involves the reaction of iridium(III) chloride or iridium trichloride hydrate with sodium acetate in aqueous or alcoholic media. Under controlled pH and temperature conditions, the hydrolysis of iridium salts occurs, and the formation of the μ3-oxo-bridged trinuclear core is promoted. The acetate ions serve both as ligands and as base to neutralize acidic byproducts, facilitating the assembly of the cluster. Purification methods include crystallization and filtration, often yielding the compound as a crystalline solid.

This iridium cluster is extensively studied for its catalytic applications, particularly in oxidation reactions. The multinuclear nature and the presence of the oxo bridge provide redox-active sites capable of facilitating electron transfer processes. Such complexes have been used as catalysts or catalyst precursors in reactions such as water oxidation, alkane hydroxylation, and other oxidation processes relevant to both industrial and environmental chemistry.

The compound’s stability and well-defined structure make it a valuable model system for investigating the electronic properties of metal-oxo clusters. Spectroscopic techniques including ultraviolet-visible (UV-Vis) absorption spectroscopy, infrared (IR) spectroscopy, and nuclear magnetic resonance (NMR) are commonly employed to characterize the complex. UV-Vis spectra typically exhibit bands related to metal-to-ligand charge transfer and d–d transitions, while IR spectroscopy confirms the presence of acetate ligands (via characteristic C=O stretching frequencies) and the μ3-oxo bridge (with an intense M–O stretching band). X-ray crystallography has provided detailed information on bond lengths, coordination geometry, and metal-metal distances, confirming the trinuclear oxo-bridged structure.

The aqueous solubility of hexa(acetato)m3-oxo-tris(aquo)triiridium acetate and its stability under various conditions allow for its use in homogeneous catalytic systems. Its redox properties are of particular interest for electrochemical applications, including water-splitting catalysis, where the efficient generation of oxygen from water is a key challenge.

In summary, hexa(acetato)m3-oxo-tris(aquo)triiridium acetate is a trinuclear iridium complex characterized by a central μ3-oxo bridge, coordinated acetate ligands, and water molecules. It serves as an important compound in organometallic and coordination chemistry with applications mainly in catalysis, especially oxidation reactions, due to its unique multinuclear and redox-active structure.
Market Analysis Reports
Related Products
Heteronemin  Heteronium  Heteronoside  Heterophyllin B  Heterotaxin  Hetisan-13-Ol  Hetisine hydroc...  Heudelotinone  Heveaflavone  Hevein  2,3,6,7,10,11-H...  Hexa-O-Acetyl-C...  Hexa-N-acetylch...  Hexa-O-Acetyl-D...  1',2,3,3',4',6'...  N,N,N',N',N'',N...  Hexaaluminium P...  Hexaaminecobalt...  2,2,4,4,6,6-Hex...  2,3,6,7,10,11-H...