Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 2-Cyclopentyl-4-(1,1-Dimethylethyl)-Phenol |
|---|---|
| Synonyms | 4-Tert-Butyl-2-Cyclopentyl-Phenol |
| Molecular Structure |  |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 |
| CAS Registry Number | 52762-67-1 |
| EINECS | 258-158-3 |
| SMILES | C1=C(C(C)(C)C)C=CC(=C1C2CCCC2)O |
| InChI | 1S/C15H22O/c1-15(2,3)12-8-9-14(16)13(10-12)11-6-4-5-7-11/h8-11,16H,4-7H2,1-3H3 |
| InChIKey | VEZHYEYZBFZZMB-UHFFFAOYSA-N |
| Density | 1.001g/cm3 (Cal.) |
|---|---|
| Boiling point | 273.589°C at 760 mmHg (Cal.) |
| Flash point | 125.485°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Cyclopentyl-4-(1,1-Dimethylethyl)-Phenol |