| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Creative Peptides | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 624-4882 | |||
![]() |
info@creative-peptides.com | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2010 | ||||
| Classification | Biochemical >> Amino acids and their derivatives >> Methionine derivatives |
|---|---|
| Name | Bz-Met-NH2 |
| Synonyms | N-(1-Carbamoyl-3-Methylsulfanyl-Propyl)Benzamide; N-[1-Carbamoyl-3-(Methylthio)Propyl]Benzamide; N-(1-Amino-4-Methylsulfanyl-1-Oxo-Butan-2-Yl)Benzamide |
| Molecular Structure | ![]() |
| Molecular Formula | C12H16N2O2S |
| Molecular Weight | 252.33 |
| CAS Registry Number | 52811-71-9 |
| SMILES | C1=CC=CC=C1C(NC(CCSC)C(N)=O)=O |
| InChI | 1S/C12H16N2O2S/c1-17-8-7-10(11(13)15)14-12(16)9-5-3-2-4-6-9/h2-6,10H,7-8H2,1H3,(H2,13,15)(H,14,16) |
| InChIKey | NBLKELFQDXBKFY-UHFFFAOYSA-N |
| Density | 1.196g/cm3 (Cal.) |
|---|---|
| Boiling point | 550.075°C at 760 mmHg (Cal.) |
| Flash point | 286.475°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Bz-Met-NH2 |