Online Database of Chemicals from Around the World
|
CAS#: 52892-98-5 Product: 2,2,4,4-Tetramethyl-1,3-Cyclobutanediyl Bismethacrylate No suppilers available for the product. |
| Name | 2,2,4,4-Tetramethyl-1,3-Cyclobutanediyl Bismethacrylate |
|---|---|
| Synonyms | 2-Methylprop-2-Enoic Acid [2,2,4,4-Tetramethyl-3-(2-Methyl-1-Oxoprop-2-Enoxy)Cyclobutyl] Ester; 2-Methylacrylic Acid (3-Methacryloyloxy-2,2,4,4-Tetramethyl-Cyclobutyl) Ester; 2,2,4,4-Tetramethyl-1,3-Cyclobutane Dimethacrylate |
| Molecular Structure |  |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 |
| CAS Registry Number | 52892-98-5 |
| EINECS | 258-240-9 |
| SMILES | CC1(C(OC(=O)C(=C)C)C(C1OC(=O)C(=C)C)(C)C)C |
| InChI | 1S/C16H24O4/c1-9(2)11(17)19-13-15(5,6)14(16(13,7)8)20-12(18)10(3)4/h13-14H,1,3H2,2,4-8H3 |
| InChIKey | DGRRQUOLUFIUOH-UHFFFAOYSA-N |
| Density | 1.03g/cm3 (Cal.) |
|---|---|
| Boiling point | 319.295°C at 760 mmHg (Cal.) |
| Flash point | 145.02°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2,4,4-Tetramethyl-1,3-Cyclobutanediyl Bismethacrylate |