| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | Inquire | ||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| Name | 1,1-Di-p-Tolylethane |
|---|---|
| Synonyms | 1,1-Di-P-Tolylethane; Benzene, 1,1'-Ethylidenebis(4-Methyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C16H18 |
| Molecular Weight | 210.32 |
| CAS Registry Number | 530-45-0 |
| EINECS | 208-480-5 |
| SMILES | C2=C(C(C)C1=CC=C(C=C1)C)C=CC(=C2)C |
| InChI | 1S/C16H18/c1-12-4-8-15(9-5-12)14(3)16-10-6-13(2)7-11-16/h4-11,14H,1-3H3 |
| InChIKey | IDONYCOFOUUWLB-UHFFFAOYSA-N |
| Density | 1.0±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 298.999°C at 760 mmHg (Cal.) |
| Flash point | 142.1±13.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1-Di-p-Tolylethane |