Online Database of Chemicals from Around the World
| Name | Para-Nitrosopropiophenone |
|---|---|
| Synonyms | 4-Nitrosopropiophenone; Brn 2574917; Propiophenone, 4'-Nitroso- |
| Molecular Structure |  |
| Molecular Formula | C9H9NO2 |
| Molecular Weight | 163.18 |
| CAS Registry Number | 53033-81-1 |
| SMILES | C1=C(C(=O)CC)C=CC(=C1)N=O |
| InChI | 1S/C9H9NO2/c1-2-9(11)7-3-5-8(10-12)6-4-7/h3-6H,2H2,1H3 |
| InChIKey | VUHULBJCIYOTTK-UHFFFAOYSA-N |
| Density | 1.108g/cm3 (Cal.) |
|---|---|
| Boiling point | 291.975°C at 760 mmHg (Cal.) |
| Flash point | 118.359°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Para-Nitrosopropiophenone |
