Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 2,3,4,5,6-Pentabromostyrene |
|---|---|
| Synonyms | 1,2,3,4,5-Pentabromo-6-Vinyl-Benzene; 1,2,3,4,5-Pentabromo-6-Vinylbenzene; 1,2,3,4,5-Pentabromo-6-Ethenyl-Benzene |
| Molecular Structure |  |
| Molecular Formula | C8H3Br5 |
| Molecular Weight | 498.63 |
| CAS Registry Number | 53097-59-9 |
| EINECS | 258-359-6 |
| SMILES | C1(=C(Br)C(=C(Br)C(=C1Br)Br)Br)C=C |
| InChI | 1S/C8H3Br5/c1-2-3-4(9)6(11)8(13)7(12)5(3)10/h2H,1H2 |
| InChIKey | BMSUWQXMTMGEOM-UHFFFAOYSA-N |
| Density | 2.54g/cm3 (Cal.) |
|---|---|
| Boiling point | 415.733°C at 760 mmHg (Cal.) |
| Flash point | 198.623°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3,4,5,6-Pentabromostyrene |