Online Database of Chemicals from Around the World
|
CAS#: 53197-77-6 Product: 2,6-Diamino-9H-Fluoren-9-One No suppilers available for the product. |
| Name | 2,6-Diamino-9H-Fluoren-9-One |
|---|---|
| Synonyms | 2,6-Diamino-9-Fluorenone; Nciopen2_003640; Nsc73093 |
| Molecular Structure |  |
| Molecular Formula | C13H10N2O |
| Molecular Weight | 210.23 |
| CAS Registry Number | 53197-77-6 |
| SMILES | C1=C(N)C=CC2=C1C(=O)C3=C2C=C(C=C3)N |
| InChI | 1S/C13H10N2O/c14-7-2-4-10-11(5-7)9-3-1-8(15)6-12(9)13(10)16/h1-6H,14-15H2 |
| InChIKey | QQHDRVBDLVUIPP-UHFFFAOYSA-N |
| Density | 1.407g/cm3 (Cal.) |
|---|---|
| Boiling point | 522.397°C at 760 mmHg (Cal.) |
| Flash point | 269.736°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,6-Diamino-9H-Fluoren-9-One |