Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 1,3-Di-6-Quinolylurea |
|---|---|
| Synonyms | 1,3-Bis(6-Quinolyl)Urea; Diarylurea 4; 1,3-Di-6-Quinolylurea |
| Molecular Structure |  |
| Molecular Formula | C19H14N4O |
| Molecular Weight | 314.35 |
| CAS Registry Number | 532-05-8 |
| EINECS | 208-525-9 |
| SMILES | C3=C(NC(NC2=CC1=CC=CN=C1C=C2)=O)C=CC4=NC=CC=C34 |
| InChI | 1S/C19H14N4O/c24-19(22-15-5-7-17-13(11-15)3-1-9-20-17)23-16-6-8-18-14(12-16)4-2-10-21-18/h1-12H,(H2,22,23,24) |
| InChIKey | MJNIRKGFUIUCQO-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 463.5±20.0°C at 760 mmHg (Cal.) |
| Flash point | 234.1±21.8°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1,3-Di-6-Quinolylurea |