|
CAS#: 532-76-3 Product: Hexylcaine Hydrochloride No suppilers available for the product. |
| Name | Hexylcaine Hydrochloride |
|---|---|
| Synonyms | [2-(Cyclohexylamino)-1-Methyl-Ethyl] Benzoate Hydrochloride; Benzoic Acid [2-(Cyclohexylamino)-1-Methylethyl] Ester Hydrochloride; Benzoic Acid [2-(Cyclohexylamino)-1-Methyl-Ethyl] Ester Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C16H24ClNO2 |
| Molecular Weight | 297.82 |
| CAS Registry Number | 532-76-3 |
| EINECS | 208-544-2 |
| SMILES | [H+].C2=C(C(OC(CNC1CCCCC1)C)=O)C=CC=C2.[Cl-] |
| InChI | 1S/C16H23NO2.ClH/c1-13(12-17-15-10-6-3-7-11-15)19-16(18)14-8-4-2-5-9-14;/h2,4-5,8-9,13,15,17H,3,6-7,10-12H2,1H3;1H |
| InChIKey | MTFCPNHRBINLRQ-UHFFFAOYSA-N |
| Market Analysis Reports |
| List of Reports Available for Hexylcaine Hydrochloride |