Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 2,2-Dichloro-N,N-Bis(1-Methylethyl)-Acetamide |
|---|---|
| Synonyms | 2,2-Dichloro-N,N-Diisopropyl-Acetamide; 2,2-Dichloro-N,N-Diisopropylacetamide; 2,2-Dichloro-N,N-Di(Propan-2-Yl)Ethanamide |
| Molecular Structure |  |
| Molecular Formula | C8H15Cl2NO |
| Molecular Weight | 212.12 |
| CAS Registry Number | 5326-93-2 |
| SMILES | CC(C)N(C(C)C)C(=O)C(Cl)Cl |
| InChI | 1S/C8H15Cl2NO/c1-5(2)11(6(3)4)8(12)7(9)10/h5-7H,1-4H3 |
| InChIKey | GWCFWYFGDBHVGX-UHFFFAOYSA-N |
| Density | 1.123g/cm3 (Cal.) |
|---|---|
| Boiling point | 243.722°C at 760 mmHg (Cal.) |
| Flash point | 101.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2-Dichloro-N,N-Bis(1-Methylethyl)-Acetamide |