Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | (1R,2S)-2-Ethynyl-1-Indanol |
|---|---|
| Synonyms | (1R,2S)-2-ethynyl-2,3-dihydro-1H-inden-1-ol |
| Molecular Structure |  |
| Molecular Formula | C11H10O |
| Molecular Weight | 158.20 |
| CAS Registry Number | 532957-65-6 |
| SMILES | C#C[C@@H]1CC2=CC=CC=C2[C@@H]1O |
| InChI | 1S/C11H10O/c1-2-8-7-9-5-3-4-6-10(9)11(8)12/h1,3-6,8,11-12H,7H2/t8-,11-/m1/s1 |
| InChIKey | JAAFSCGYVGAYRW-LDYMZIIASA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 276.2±39.0°C at 760 mmHg (Cal.) |
| Flash point | 127.8±20.1°C (Cal.) |
| Refractive index | 1.606 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1R,2S)-2-Ethynyl-1-Indanol |