|
CAS#: 533-42-6 Product: Sodium 3-Phenylacrylate No suppilers available for the product. |
| Name | Sodium 3-Phenylacrylate |
|---|---|
| Synonyms | 3-Phenyl-2-propenoic acid sodium salt; Cinnamic acid sodium salt; Sodium cinnamate |
| Molecular Structure | ![]() |
| Molecular Formula | C9H7NaO2 |
| Molecular Weight | 170.14 |
| CAS Registry Number | 533-42-6 |
| SMILES | c1ccc(cc1)C=CC(=O)[O-].[Na+] |
| InChI | 1S/C9H8O2.Na/c10-9(11)7-6-8-4-2-1-3-5-8;/h1-7H,(H,10,11);/q;+1/p-1 |
| InChIKey | DXIHILNWDOYYCH-UHFFFAOYSA-M |
| Market Analysis Reports |
| List of Reports Available for Sodium 3-Phenylacrylate |