Online Database of Chemicals from Around the World
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
 |
+380 (44) 522-2458 | |||
 |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 4,6-Dichloro-2-Phenylphenol |
|---|---|
| Synonyms | 2,4-Dichloro-6-Phenyl-Phenol; (1,1'-Biphenyl)-2-Ol, 3,5-Dichloro-; 2-Biphenylol, 3,5-Dichloro- (8Ci) |
| Molecular Structure |  |
| Molecular Formula | C12H8Cl2O |
| Molecular Weight | 239.10 |
| CAS Registry Number | 5335-24-0 |
| SMILES | C2=C(C1=CC=CC=C1)C(=C(C=C2Cl)Cl)O |
| InChI | 1S/C12H8Cl2O/c13-9-6-10(12(15)11(14)7-9)8-4-2-1-3-5-8/h1-7,15H |
| InChIKey | AFXPPGXJWHJULD-UHFFFAOYSA-N |
| Density | 1.35g/cm3 (Cal.) |
|---|---|
| Boiling point | 336.535°C at 760 mmHg (Cal.) |
| Flash point | 133.038°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,6-Dichloro-2-Phenylphenol |