Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 3-Nitrobenzenesulfonic Acid Monohydrate |
|---|---|
| Synonyms | Nsc419; Phosphonic Acid, (3-Nitrophenyl)-; Phosphonic Acid, (M-Nitrophenyl)- |
| Molecular Structure |  |
| Molecular Formula | C6H6NO5P |
| Molecular Weight | 203.09 |
| CAS Registry Number | 5337-19-9 |
| EINECS | 226-261-2 |
| SMILES | C1=C(C=CC=C1[P](O)(O)=O)[N+](=O)[O-] |
| InChI | 1S/C6H6NO5P/c8-7(9)5-2-1-3-6(4-5)13(10,11)12/h1-4H,(H2,10,11,12) |
| InChIKey | OXWXINKWKITCIH-UHFFFAOYSA-N |
| Density | 1.649g/cm3 (Cal.) |
|---|---|
| Boiling point | 446.345°C at 760 mmHg (Cal.) |
| Flash point | 223.741°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 3-Nitrobenzenesulfonic Acid Monohydrate |