Online Database of Chemicals from Around the World
| Name | 4-Nitro-3-Hexanol |
|---|---|
| Synonyms | Nsc3644 |
| Molecular Structure |  |
| Molecular Formula | C6H13NO3 |
| Molecular Weight | 147.17 |
| CAS Registry Number | 5342-71-2 |
| SMILES | C(C(C(CC)O)[N+](=O)[O-])C |
| InChI | 1S/C6H13NO3/c1-3-5(7(9)10)6(8)4-2/h5-6,8H,3-4H2,1-2H3 |
| InChIKey | XIXNQTGGBNDDMJ-UHFFFAOYSA-N |
| Density | 1.062g/cm3 (Cal.) |
|---|---|
| Boiling point | 233.465°C at 760 mmHg (Cal.) |
| Flash point | 100.103°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4-Nitro-3-Hexanol |
