| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | Inquire | ||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| Name | 2,2,4-Trimethyl-4-Nitropentane |
|---|---|
| Synonyms | 2,2,4-Trimethyl-4-Nitro-Pentane; 2-Nitro-2,4,4-Trimethylpentane; Nsc3658 |
| Molecular Structure | ![]() |
| Molecular Formula | C8H17NO2 |
| Molecular Weight | 159.23 |
| CAS Registry Number | 5342-78-9 |
| SMILES | C(C([N+]([O-])=O)(C)C)C(C)(C)C |
| InChI | 1S/C8H17NO2/c1-7(2,3)6-8(4,5)9(10)11/h6H2,1-5H3 |
| InChIKey | CUEFTLGHWYSCTO-UHFFFAOYSA-N |
| Density | 0.918g/cm3 (Cal.) |
|---|---|
| Boiling point | 203.099°C at 760 mmHg (Cal.) |
| Flash point | 61.383°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2,4-Trimethyl-4-Nitropentane |