Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1-Allyl-4-Nitrobenzene |
|---|---|
| Synonyms | 1-Allyl-4-nitrobenzene # |
| Molecular Structure |  |
| Molecular Formula | C9H9NO2 |
| Molecular Weight | 163.17 |
| CAS Registry Number | 53483-17-3 |
| SMILES | [O-][N+](=O)c1ccc(cc1)C\C=C |
| InChI | 1S/C9H9NO2/c1-2-3-8-4-6-9(7-5-8)10(11)12/h2,4-7H,1,3H2 |
| InChIKey | UCHCAUUKJXSNAT-UHFFFAOYSA-N |
| Density | 1.12g/cm3 (Cal.) |
|---|---|
| Boiling point | 263.783°C at 760 mmHg (Cal.) |
| Flash point | 116.321°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Allyl-4-Nitrobenzene |