Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | D-Glucoheptulose |
|---|---|
| Synonyms | D-Gluco-2-Heptulose |
| Molecular Structure |  |
| Molecular Formula | C7H14O7 |
| Molecular Weight | 210.18 |
| CAS Registry Number | 5349-37-1 |
| EINECS | 226-310-8 |
| SMILES | [C@@H](CO)([C@H]([C@@H]([C@H](C(CO)=O)O)O)O)O |
| InChI | 1S/C7H14O7/c8-1-3(10)5(12)7(14)6(13)4(11)2-9/h3,5-10,12-14H,1-2H2/t3-,5-,6+,7+/m1/s1 |
| InChIKey | HSNZZMHEPUFJNZ-UMWONPOSSA-N |
| Density | 1.645g/cm3 (Cal.) |
|---|---|
| Boiling point | 628.035°C at 760 mmHg (Cal.) |
| Flash point | 347.632°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for D-Glucoheptulose |