Online Database of Chemicals from Around the World
|
CAS#: 53527-47-2 Product: (9b,13a,14b)-3-Hydroxy-9,13-dimethyl-24,25,26,30-Tetranoroleana-1(10),3,5,7,20-pentaen-2-one No suppilers available for the product. |
| Name | (9b,13a,14b)-3-Hydroxy-9,13-dimethyl-24,25,26,30-Tetranoroleana-1(10),3,5,7,20-pentaen-2-one |
|---|---|
| Synonyms | D:A-Friedo-24,30-Dinoroleana-1(10),3,5,7,20-Pentaen-2-One, 3-Hydroxy-; Iguesterin; Isoiguesterin |
| Molecular Structure |  |
| Molecular Formula | C28H36O2 |
| Molecular Weight | 404.59 |
| CAS Registry Number | 53527-47-2 |
| SMILES | CC24C1=CC(C(=C(C1=CC=C2C3(CCC5(C(C3(CC4)C)CC(=CC5)C)C)C)C)O)=O |
| InChI | 1S/C28H36O2/c1-17-9-10-25(3)11-13-27(5)22-8-7-19-18(2)24(30)21(29)16-20(19)26(22,4)12-14-28(27,6)23(25)15-17/h7-9,16,23,30H,10-15H2,1-6H3 |
| InChIKey | FLMDVQMCMIGPEK-UHFFFAOYSA-N |
| Density | 1.139g/cm3 (Cal.) |
|---|---|
| Boiling point | 574.608°C at 760 mmHg (Cal.) |
| Flash point | 240.826°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (9b,13a,14b)-3-Hydroxy-9,13-dimethyl-24,25,26,30-Tetranoroleana-1(10),3,5,7,20-pentaen-2-one |