Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 4-(5-Nonanyl)Pyridine 1-Oxide |
|---|---|
| Synonyms | 4-(5-NONYL)-PYRIDINEN-OXIDE |
| Molecular Structure |  |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 |
| CAS Registry Number | 53534-29-5 |
| SMILES | CCCCC(CCCC)c1cc[n+]([O-])cc1 |
| InChI | 1S/C14H23NO/c1-3-5-7-13(8-6-4-2)14-9-11-15(16)12-10-14/h9-13H,3-8H2,1-2H3 |
| InChIKey | LQZUVUANAHQVJU-UHFFFAOYSA-N |
| Density | 0.939g/cm3 (Cal.) |
|---|---|
| Boiling point | 361.311°C at 760 mmHg (Cal.) |
| Flash point | 172.315°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(5-Nonanyl)Pyridine 1-Oxide |