Online Database of Chemicals from Around the World
|
CAS#: 5355-88-4 Product: 1-Amino-6,7-Dichloroanthraquinone No suppilers available for the product. |
| Name | 1-Amino-6,7-Dichloroanthraquinone |
|---|---|
| Synonyms | 1-Amino-6,7-Dichloro-Anthracene-9,10-Dione; 1-Amino-6,7-Dichloro-9,10-Anthraquinone; Nsc 239330 |
| Molecular Structure |  |
| Molecular Formula | C14H7Cl2NO2 |
| Molecular Weight | 292.12 |
| CAS Registry Number | 5355-88-4 |
| EINECS | 226-340-1 |
| SMILES | C1=C(Cl)C(=CC3=C1C(C2=C(C=CC=C2C3=O)N)=O)Cl |
| InChI | 1S/C14H7Cl2NO2/c15-9-4-7-8(5-10(9)16)14(19)12-6(13(7)18)2-1-3-11(12)17/h1-5H,17H2 |
| InChIKey | YFEHGCGWUWOAFA-UHFFFAOYSA-N |
| Density | 1.577g/cm3 (Cal.) |
|---|---|
| Boiling point | 527.881°C at 760 mmHg (Cal.) |
| Flash point | 273.053°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1-Amino-6,7-Dichloroanthraquinone |