|
CAS#: 53555-65-0 Product: 1,2,3,5,7-Pentachloronaphthalene No suppilers available for the product. |
| Name | 1,2,3,5,7-Pentachloronaphthalene |
|---|---|
| Synonyms | Naphthalene, 1,2,3,5,7-Pentachloro; Naphthalene, 1,2,3,5,7-Pentachloro- |
| Molecular Structure | ![]() |
| Molecular Formula | C10H3Cl5 |
| Molecular Weight | 300.40 |
| CAS Registry Number | 53555-65-0 |
| SMILES | C2=C(C1=CC(=C(C(=C1C=C2Cl)Cl)Cl)Cl)Cl |
| InChI | 1S/C10H3Cl5/c11-4-1-6-5(7(12)2-4)3-8(13)10(15)9(6)14/h1-3H |
| InChIKey | OVSKLQPHXHPXDR-UHFFFAOYSA-N |
| Density | 1.639g/cm3 (Cal.) |
|---|---|
| Boiling point | 366.273°C at 760 mmHg (Cal.) |
| Flash point | 181.04°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,3,5,7-Pentachloronaphthalene |