Online Database of Chemicals from Around the World
|
CAS#: 53580-48-6 Product: 2,2,2-Trimethyldisilane-1,1,1-Triyl Triacetate No suppilers available for the product. |
| Name | 2,2,2-Trimethyldisilane-1,1,1-Triyl Triacetate |
|---|---|
| Synonyms | (Diacetoxy-Trimethylsilyl-Silyl) Acetate; Acetic Acid (Diacetoxy-Trimethylsilylsilyl) Ester; Acetic Acid (Diacetoxy-Trimethylsilyl-Silyl) Ester |
| Molecular Structure |  |
| Molecular Formula | C9H18O6Si2 |
| Molecular Weight | 278.41 |
| CAS Registry Number | 53580-48-6 |
| EINECS | 258-640-3 |
| SMILES | C[Si]([Si](OC(=O)C)(OC(=O)C)OC(=O)C)(C)C |
| InChI | 1S/C9H18O6Si2/c1-7(10)13-17(14-8(2)11,15-9(3)12)16(4,5)6/h1-6H3 |
| InChIKey | UDTVKJFJPHLKQE-UHFFFAOYSA-N |
| Density | 1.075g/cm3 (Cal.) |
|---|---|
| Boiling point | 258.152°C at 760 mmHg (Cal.) |
| Flash point | 91.427°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2,2-Trimethyldisilane-1,1,1-Triyl Triacetate |