Online Database of Chemicals from Around the World
|
CAS#: 53620-50-1 Product: Triacetoxy(3-Chloropropyl)Silane No suppilers available for the product. |
| Name | Triacetoxy(3-Chloropropyl)Silane |
|---|---|
| Synonyms | (Diacetoxy-(3-Chloropropyl)Silyl) Acetate; Acetic Acid (Diacetoxy-(3-Chloropropyl)Silyl) Ester; (Diacetyloxy-(3-Chloropropyl)Silyl) Ethanoate |
| Molecular Structure |  |
| Molecular Formula | C9H15ClO6Si |
| Molecular Weight | 282.75 |
| CAS Registry Number | 53620-50-1 |
| EINECS | 258-664-4 |
| SMILES | C([Si](OC(=O)C)(OC(=O)C)OC(=O)C)CCCl |
| InChI | 1S/C9H15ClO6Si/c1-7(11)14-17(6-4-5-10,15-8(2)12)16-9(3)13/h4-6H2,1-3H3 |
| InChIKey | YDVQLGHYJSJBKA-UHFFFAOYSA-N |
| Density | 1.205g/cm3 (Cal.) |
|---|---|
| Boiling point | 278.445°C at 760 mmHg (Cal.) |
| Flash point | 122.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Triacetoxy(3-Chloropropyl)Silane |