Online Database of Chemicals from Around the World
|
CAS#: 5363-32-6 Product: 2-(Isopropylamino)Benzamide No suppilers available for the product. |
| Name | 2-(Isopropylamino)Benzamide |
|---|---|
| Synonyms | 2-(Isopropylamino)Benzamide; Brn 0778972; Benzamide, 2-((1-Methylethyl)Amino)- |
| Molecular Structure |  |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 |
| CAS Registry Number | 5363-32-6 |
| SMILES | C1=CC=CC(=C1C(N)=O)NC(C)C |
| InChI | 1S/C10H14N2O/c1-7(2)12-9-6-4-3-5-8(9)10(11)13/h3-7,12H,1-2H3,(H2,11,13) |
| InChIKey | HFZWIOMMCVHMSX-UHFFFAOYSA-N |
| Density | 1.107g/cm3 (Cal.) |
|---|---|
| Boiling point | 335.066°C at 760 mmHg (Cal.) |
| Flash point | 156.443°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(Isopropylamino)Benzamide |