| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | Inquire | ||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| Name | (2,3-Dimethoxybenzyl)Methylamine |
|---|---|
| Synonyms | (2,3-Dimethoxyphenyl)Methyl-Methyl-Ammonium; (2,3-Dimethoxyphenyl)Methyl-Methylammonium; (2,3-Dimethoxybenzyl)-Methyl-Ammonium |
| Molecular Structure | ![]() |
| Molecular Formula | C10H16NO2 |
| Molecular Weight | 182.24 |
| CAS Registry Number | 53663-28-8 |
| SMILES | C1=CC=C(OC)C(=C1C[NH2+]C)OC |
| InChI | 1S/C10H15NO2/c1-11-7-8-5-4-6-9(12-2)10(8)13-3/h4-6,11H,7H2,1-3H3/p+1 |
| InChIKey | UKKGAJSVGVCQAJ-UHFFFAOYSA-O |
| Boiling point | 244.178°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 97.805°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2,3-Dimethoxybenzyl)Methylamine |