| Name | (Z)-4-[3-[2-(Trifluoromethyl)-9H-Thioxanthen-9-Ylidene]Propyl]Piperazine-1-Ethanol |
|---|---|
| Synonyms | 2-[4-[(3Z)-3-[2-(Trifluoromethyl)-9-Thioxanthenylidene]Propyl]-1-Piperazinyl]Ethanol; Lopac0_000528; Prestwick2_000340 |
| Molecular Structure | ![]() |
| Molecular Formula | C23H25F3N2OS |
| Molecular Weight | 434.52 |
| CAS Registry Number | 53772-82-0 |
| EINECS | 258-756-4 |
| SMILES | C1=C(C(F)(F)F)C=CC3=C1\C(C2=C(C=CC=C2)S3)=C/CCN4CCN(CCO)CC4 |
| InChI | 1S/C23H25F3N2OS/c24-23(25,26)17-7-8-22-20(16-17)18(19-4-1-2-6-21(19)30-22)5-3-9-27-10-12-28(13-11-27)14-15-29/h1-2,4-8,16,29H,3,9-15H2/b18-5- |
| InChIKey | NJMYODHXAKYRHW-DVZOWYKESA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 554.7±50.0°C at 760 mmHg (Cal.) |
| Flash point | 289.3±30.1°C (Cal.) |
| (1) | Diamandis et al.. Chemical genetics reveal a complex functional ground state of neural stem cells, Nature Chemical Biology, 2007 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (Z)-4-[3-[2-(Trifluoromethyl)-9H-Thioxanthen-9-Ylidene]Propyl]Piperazine-1-Ethanol |