Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 5-Amino-2,4-Dimethylacetanilide |
|---|---|
| Synonyms | N-(5-Amino-2,4-Dimethyl-Phenyl)Acetamide; N-(5-Amino-2,4-Dimethyl-Phenyl)Ethanamide |
| Molecular Structure |  |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 |
| CAS Registry Number | 53780-33-9 |
| EINECS | 258-766-9 |
| SMILES | C1=C(C)C(=CC(=C1C)N)NC(=O)C |
| InChI | 1S/C10H14N2O/c1-6-4-7(2)10(5-9(6)11)12-8(3)13/h4-5H,11H2,1-3H3,(H,12,13) |
| InChIKey | HAEMXAKFQGXEGU-UHFFFAOYSA-N |
| Density | 1.133g/cm3 (Cal.) |
|---|---|
| Boiling point | 358.588°C at 760 mmHg (Cal.) |
| Flash point | 170.668°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Amino-2,4-Dimethylacetanilide |