Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Cyclopentamine Hydrochloride |
|---|---|
| Synonyms | 1-Cyclopentyl-N-Methyl-Propan-2-Amine Hydrochloride; (2-Cyclopentyl-1-Methyl-Ethyl)-Methyl-Amine Hydrochloride; (+-)-Cyclopentamine Hydrochloride |
| Molecular Structure |  |
| Molecular Formula | C9H20ClN |
| Molecular Weight | 177.72 |
| CAS Registry Number | 538-02-3 |
| EINECS | 208-681-8 |
| SMILES | [H+].C(C1CCCC1)C(NC)C.[Cl-] |
| InChI | 1S/C9H19N.ClH/c1-8(10-2)7-9-5-3-4-6-9;/h8-10H,3-7H2,1-2H3;1H |
| InChIKey | XGZPRABQSGUFBL-UHFFFAOYSA-N |
| Market Analysis Reports |
| List of Reports Available for Cyclopentamine Hydrochloride |