Online Database of Chemicals from Around the World
|
CAS#: 5386-11-8 Product: 5-Nitro-1-Acenaphthenone No suppilers available for the product. |
| Name | 5-Nitro-1-Acenaphthenone |
|---|---|
| Synonyms | 5-Nitro-1-Acenaphthenone; 5-Nitro-1(2H)-Acenaphthylenone; Brn 2332458 |
| Molecular Structure |  |
| Molecular Formula | C12H7NO3 |
| Molecular Weight | 213.19 |
| CAS Registry Number | 5386-11-8 |
| SMILES | C1=CC=C3C2=C1C(CC2=CC=C3[N+]([O-])=O)=O |
| InChI | 1S/C12H7NO3/c14-11-6-7-4-5-10(13(15)16)8-2-1-3-9(11)12(7)8/h1-5H,6H2 |
| InChIKey | KSISVVBHVWCKOY-UHFFFAOYSA-N |
| Density | 1.488g/cm3 (Cal.) |
|---|---|
| Boiling point | 418.343°C at 760 mmHg (Cal.) |
| Flash point | 219.147°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Nitro-1-Acenaphthenone |