Online Database of Chemicals from Around the World
|
CAS#: 53874-67-2 Product: 1-(Dibromomethyl)-3-Phenoxybenzene No suppilers available for the product. |
| Name | 1-(Dibromomethyl)-3-Phenoxybenzene |
|---|---|
| Synonyms | 1-(Dibromomethyl)-3-Phenoxybenzene; Benzene, 1-(Dibromomethyl)-3-Phenoxy- |
| Molecular Structure |  |
| Molecular Formula | C13H10Br2O |
| Molecular Weight | 342.03 |
| CAS Registry Number | 53874-67-2 |
| EINECS | 258-832-7 |
| SMILES | C1=CC=C(C=C1C(Br)Br)OC2=CC=CC=C2 |
| InChI | 1S/C13H10Br2O/c14-13(15)10-5-4-8-12(9-10)16-11-6-2-1-3-7-11/h1-9,13H |
| InChIKey | XGCVFGOKEISJGC-UHFFFAOYSA-N |
| Density | 1.681g/cm3 (Cal.) |
|---|---|
| Boiling point | 360.408°C at 760 mmHg (Cal.) |
| Flash point | 147.279°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(Dibromomethyl)-3-Phenoxybenzene |