Online Database of Chemicals from Around the World
| Name | 1-(Dichloromethyl)-3-Phenoxybenzene |
|---|---|
| Synonyms | 1-(Dichloromethyl)-3-Phenoxybenzene; 3-Phenoxybenzal Chloride; Brn 1966430 |
| Molecular Structure |  |
| Molecular Formula | C13H10Cl2O |
| Molecular Weight | 253.13 |
| CAS Registry Number | 53874-68-3 |
| EINECS | 258-833-2 |
| SMILES | C1=C(C(Cl)Cl)C=CC=C1OC2=CC=CC=C2 |
| InChI | 1S/C13H10Cl2O/c14-13(15)10-5-4-8-12(9-10)16-11-6-2-1-3-7-11/h1-9,13H |
| InChIKey | JOVSDWRNVGOQNK-UHFFFAOYSA-N |
| Density | 1.267g/cm3 (Cal.) |
|---|---|
| Boiling point | 337.236°C at 760 mmHg (Cal.) |
| Flash point | 110.262°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(Dichloromethyl)-3-Phenoxybenzene |
