Online Database of Chemicals from Around the World
|
CAS#: 5394-86-5 Product: 1-(Phenylmethylene)-1H-Indene No suppilers available for the product. |
| Name | 1-(Phenylmethylene)-1H-Indene |
|---|---|
| Synonyms | 1-(Phenylmethylidene)Indene; (1E)-1-(Phenylmethylene)Indene; 1-(Phenylmethylene)Indene |
| Molecular Structure |  |
| Molecular Formula | C16H12 |
| Molecular Weight | 204.27 |
| CAS Registry Number | 5394-86-5 |
| SMILES | C1=CC3=C(C=C1)\C(=C\C2=CC=CC=C2)C=C3 |
| InChI | 1S/C16H12/c1-2-6-13(7-3-1)12-15-11-10-14-8-4-5-9-16(14)15/h1-12H/b15-12+ |
| InChIKey | SJWIOZSGMUJDFJ-NTCAYCPXSA-N |
| Density | 1.137g/cm3 (Cal.) |
|---|---|
| Boiling point | 339.943°C at 760 mmHg (Cal.) |
| Flash point | 168.969°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(Phenylmethylene)-1H-Indene |