Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 1-Phenyl-1H-Pyrazolo[3,4-d]Pyrimidine-4,6-Diamine |
|---|---|
| Synonyms | (6-Amino-1-Phenyl-Pyrazolo[4,5-E]Pyrimidin-4-Yl)Amine; Nsc4913 |
| Molecular Structure | ![CAS#: 5399-88-2， 1-Phenyl-1H-Pyrazolo[3,4-d]Pyrimidine-4,6-Diamine](/moreStructures/5399-88-2.gif) |
| Molecular Formula | C11H10N6 |
| Molecular Weight | 226.24 |
| CAS Registry Number | 5399-88-2 |
| SMILES | C2=N[N](C1=CC=CC=C1)C3=C2C(=NC(=N3)N)N |
| InChI | 1S/C11H10N6/c12-9-8-6-14-17(7-4-2-1-3-5-7)10(8)16-11(13)15-9/h1-6H,(H4,12,13,15,16) |
| InChIKey | JUCSNAMHVJOWAV-UHFFFAOYSA-N |
| Density | 1.586g/cm3 (Cal.) |
|---|---|
| Boiling point | 466.58°C at 760 mmHg (Cal.) |
| Flash point | 235.979°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Phenyl-1H-Pyrazolo[3,4-d]Pyrimidine-4,6-Diamine |