Online Database of Chemicals from Around the World
| Name | 4-Bromophenyl Chloromethyl Sulfone |
|---|---|
| Synonyms | 4-Bromophenyl Chloromethyl Sulfone; 1-Bromo-4-((Chloromethyl)Sulfonyl)Benzene; 4-Bromophenylchloromethyl Sulfone |
| Molecular Structure |  |
| Molecular Formula | C7H6BrClO2S |
| Molecular Weight | 269.54 |
| CAS Registry Number | 54091-06-4 |
| SMILES | C1=CC(=CC=C1Br)[S](=O)(=O)CCl |
| InChI | 1S/C7H6BrClO2S/c8-6-1-3-7(4-2-6)12(10,11)5-9/h1-4H,5H2 |
| InChIKey | AHXUVTKVCMOKIX-UHFFFAOYSA-N |
| Density | 1.698g/cm3 (Cal.) |
|---|---|
| Boiling point | 381.454°C at 760 mmHg (Cal.) |
| Flash point | 184.497°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Bromophenyl Chloromethyl Sulfone |
