Online Database of Chemicals from Around the World
| Mascot I.E. CO.,Ltd. | China | Inquire | ||
|---|---|---|---|---|
 | www.mascotchem.com | |||
 | +86 (519) 8501-0339 +86 13584504415 | |||
 | +86 (519) 8501-0366 | |||
 | info@mascotchem.com | |||
 | QQ Chat | |||
| Chemical distributor since 2006 | ||||
| chemBlink Standard supplier since 2006 | ||||
| Name | (4-Chlorophenyl) (4-hydroxy-3,5-dimethoxyphenyl) ketone |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C15H13ClO4 |
| Molecular Weight | 292.71 |
| CAS Registry Number | 54094-08-5 |
| EC Number | 258-973-4 |
| SMILES | COC1=CC(=CC(=C1O)OC)C(=O)C2=CC=C(C=C2)Cl |
| Density | 1.3±0.1 g/cm3, Calc.* |
|---|---|
| Refractive index | 1.589, Calc.* |
| Boiling point | 477.7±45.0 °C (760 mmHg), Calc.* |
| Flash point | 242.7±28.7 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for (4-Chlorophenyl) (4-hydroxy-3,5-dimethoxyphenyl) ketone |