Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Vitas-M | Russian Federation | Inquire | ||
|---|---|---|---|---|
|
+7 (906) 781-2021 | |||
|
vitas@vitasmlab.com | |||
| Chemical manufacturer since 1998 | ||||
| Name | 3-Amino-1,2,4-Benzotriazine-1-N-Oxide |
|---|---|
| Synonyms | (1-Oxido-1,2,4-Benzotriazin-1-Ium-3-Yl)Amine; 1,2,4-Benzotriazin-3-Amine 1-Oxide; 1,2,4-Benzotriazine, 3-Amino-, 1-Oxide |
| Molecular Structure |  |
| Molecular Formula | C7H6N4O |
| Molecular Weight | 162.15 |
| CAS Registry Number | 5424-06-6 |
| EINECS | 226-559-2 |
| SMILES | C1=C2C(=CC=C1)N=C(N)N=[N+]2[O-] |
| InChI | 1S/C7H6N4O/c8-7-9-5-3-1-2-4-6(5)11(12)10-7/h1-4H,(H2,8,9,10) |
| InChIKey | BBRWGJRKAHEZBG-UHFFFAOYSA-N |
| Density | 1.583g/cm3 (Cal.) |
|---|---|
| Boiling point | 433.398°C at 760 mmHg (Cal.) |
| Flash point | 215.911°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 3-Amino-1,2,4-Benzotriazine-1-N-Oxide |