Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | Ethyltriphenyltin |
|---|---|
| Synonyms | Ethyltriphenylstannane; Ethyltriphenyltin; Nsc12110 |
| Molecular Structure |  |
| Molecular Formula | C20H20Sn |
| Molecular Weight | 379.07 |
| CAS Registry Number | 5424-25-9 |
| SMILES | C3=C([Sn](C1=CC=CC=C1)(C2=CC=CC=C2)CC)C=CC=C3 |
| InChI | 1S/3C6H5.C2H5.Sn/c3*1-2-4-6-5-3-1;1-2;/h3*1-5H;1H2,2H3; |
| InChIKey | IAJWDDOJYUXIHE-UHFFFAOYSA-N |
| Boiling point | 409.92°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 205.176°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyltriphenyltin |