Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 3-(Methylamino)-2(1H)-Quinoxalinethione |
|---|---|
| Synonyms | Brn 0743416; 2-Methylamino-3-Mercaptoquinoxaline; 2-Quinoxalineamine, 3-Mercapto-N-Methyl- |
| Molecular Structure |  |
| Molecular Formula | C9H9N3S |
| Molecular Weight | 191.25 |
| CAS Registry Number | 54253-31-5 |
| SMILES | C1=CC=CC2=C1N=C(C(N2)=S)NC |
| InChI | 1S/C9H9N3S/c1-10-8-9(13)12-7-5-3-2-4-6(7)11-8/h2-5H,1H3,(H,10,11)(H,12,13) |
| InChIKey | YAWXXIUFHZKRIW-UHFFFAOYSA-N |
| Density | 1.344g/cm3 (Cal.) |
|---|---|
| Boiling point | 330.309°C at 760 mmHg (Cal.) |
| Flash point | 153.566°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(Methylamino)-2(1H)-Quinoxalinethione |