Online Database of Chemicals from Around the World
|
CAS#: 5432-38-2 Product: 1-Bromo-1,1-Dinitroethane No suppilers available for the product. |
| Name | 1-Bromo-1,1-Dinitroethane |
|---|---|
| Synonyms | 1-Bromo-1,1-Dinitro-Ethane; Brn 1768474; Nsc 16147 |
| Molecular Structure |  |
| Molecular Formula | C2H3BrN2O4 |
| Molecular Weight | 198.96 |
| CAS Registry Number | 5432-38-2 |
| SMILES | CC([N+](=O)[O-])([N+](=O)[O-])Br |
| InChI | 1S/C2H3BrN2O4/c1-2(3,4(6)7)5(8)9/h1H3 |
| InChIKey | OQEQLVCWFCJMAT-UHFFFAOYSA-N |
| Density | 1.983g/cm3 (Cal.) |
|---|---|
| Boiling point | 169.512°C at 760 mmHg (Cal.) |
| Flash point | 56.319°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Bromo-1,1-Dinitroethane |