| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 13417589054/ | |||
![]() |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | (1R,2R,7aR)-Hexahydro-1H-Pyrrolizine-1,2-Diol |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.18 |
| CAS Registry Number | 543690-37-5 |
| SMILES | C1C[C@@H]2[C@H]([C@@H](CN2C1)O)O |
| InChI | 1S/C7H13NO2/c9-6-4-8-3-1-2-5(8)7(6)10/h5-7,9-10H,1-4H2/t5-,6-,7-/m1/s1 |
| InChIKey | XHEOEYOAGDXLAA-FSDSQADBSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 271.5±7.0°C at 760 mmHg (Cal.) |
| Flash point | 151.4±16.8°C (Cal.) |
| Refractive index | 1.589 (Cal.) |
| (1) | Tahar Ayad, Yves Génisson and Michel Baltas. Asymmetric syntheses of (-)-lentiginosine and an original pyrrolizidinic analogue thereof from a versatile epoxyamine intermediate, Org. Biomol. Chem., 2005, 3, 2626. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (1R,2R,7aR)-Hexahydro-1H-Pyrrolizine-1,2-Diol |