Online Database of Chemicals from Around the World
|
CAS#: 5437-69-4 Product: 1-Methylsulfonyl-3,3-Dinitro-Butane No suppilers available for the product. |
| Name | 1-Methylsulfonyl-3,3-Dinitro-Butane |
|---|---|
| Synonyms | 1-Methylsulfonyl-3,3-Dinitro-Butane; 3,3-Dinitrobutylsulfonylmethane; Nsc16178 |
| Molecular Structure |  |
| Molecular Formula | C5H10N2O6S |
| Molecular Weight | 226.20 |
| CAS Registry Number | 5437-69-4 |
| SMILES | C(C[S](=O)(=O)C)C([N+]([O-])=O)([N+]([O-])=O)C |
| InChI | 1S/C5H10N2O6S/c1-5(6(8)9,7(10)11)3-4-14(2,12)13/h3-4H2,1-2H3 |
| InChIKey | GSQPGCJEAKMRMD-UHFFFAOYSA-N |
| Density | 1.434g/cm3 (Cal.) |
|---|---|
| Boiling point | 417.174°C at 760 mmHg (Cal.) |
| Flash point | 206.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Methylsulfonyl-3,3-Dinitro-Butane |