Online Database of Chemicals from Around the World
| Dalton Pharma Services | Canada | Inquire | ||
|---|---|---|---|---|
 |
+1 (416) 661-2102 | |||
 |
chemist@dalton.com | |||
| Chemical manufacturer | ||||
| Name | 6-Benzylamino-9-Methylpurine |
|---|---|
| Synonyms | 9-Methyl-N-(Phenylmethyl)-6-Purinamine; Benzyl-(9-Methylpurin-6-Yl)Amine; Nsc15191 |
| Molecular Structure |  |
| Molecular Formula | C13H13N5 |
| Molecular Weight | 239.28 |
| CAS Registry Number | 5440-16-4 |
| SMILES | C1=NC2=C([N]1C)N=CN=C2NCC3=CC=CC=C3 |
| InChI | 1S/C13H13N5/c1-18-9-17-11-12(15-8-16-13(11)18)14-7-10-5-3-2-4-6-10/h2-6,8-9H,7H2,1H3,(H,14,15,16) |
| InChIKey | WWWMKWQCRJJMPZ-UHFFFAOYSA-N |
| Density | 1.292g/cm3 (Cal.) |
|---|---|
| Boiling point | 452.234°C at 760 mmHg (Cal.) |
| Flash point | 227.303°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Benzylamino-9-Methylpurine |