| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | Inquire | ||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| Name | 2,4-Dicyano-3-Methylglutaramide |
|---|---|
| Synonyms | 2,4-Dicyano-3-Methyl-Pentanediamide; 2,4-Dicyano-3-Methyl-Glutaramide; .Alpha.,.Gamma.-Dicyano-.Beta.-Methyl Glutaramide |
| Molecular Structure | ![]() |
| Molecular Formula | C8H10N4O2 |
| Molecular Weight | 194.19 |
| CAS Registry Number | 5447-66-5 |
| EINECS | 226-665-9 |
| SMILES | CC(C(C(N)=O)C#N)C(C(N)=O)C#N |
| InChI | 1S/C8H10N4O2/c1-4(5(2-9)7(11)13)6(3-10)8(12)14/h4-6H,1H3,(H2,11,13)(H2,12,14) |
| InChIKey | XLQBCZSOEGHLAA-UHFFFAOYSA-N |
| Market Analysis Reports |
| List of Reports Available for 2,4-Dicyano-3-Methylglutaramide |