Online Database of Chemicals from Around the World
|
CAS#: 54499-06-8 Product: 1,3,4,6,7-Pentaazacyclo[3.3.3]Azine No suppilers available for the product. |
| Name | 1,3,4,6,7-Pentaazacyclo[3.3.3]Azine |
|---|---|
| Synonyms | 1,3,4,6,7-Pentaazacycl(3.3.3)Azine |
| Molecular Structure | ![CAS#: 54499-06-8， 1,3,4,6,7-Pentaazacyclo[3.3.3]Azine](/moreStructures/54499-06-8.gif) |
| Molecular Formula | C7H4N6 |
| Molecular Weight | 172.15 |
| CAS Registry Number | 54499-06-8 |
| SMILES | C3=C1N2C(=NC=N1)N=CN=C2N=C3 |
| InChI | 1S/C7H4N6/c1-2-8-6-11-4-12-7-10-3-9-5(1)13(6)7/h1-4H |
| InChIKey | FVHMYFABPKUJKH-UHFFFAOYSA-N |
| Density | 1.831g/cm3 (Cal.) |
|---|---|
| Boiling point | 296.991°C at 760 mmHg (Cal.) |
| Flash point | 133.416°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3,4,6,7-Pentaazacyclo[3.3.3]Azine |